C11H16F3N5OS2 — CID 57214200
3-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]butanamide (PubChem CID 57214200) has the molecular formula C11H16F3N5OS2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]butanamide.
| Compound Name | 3-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]butanamide |
|---|---|
| PubChem CID | 57214200 |
| Molecular Formula | C11H16F3N5OS2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]butanamide |
| SMILES | CC(CC(N)=O)SCc1csc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N5OS2/c1-6(2-8(15)20)21-3-7-4-22-10(18-7)19-9(16)17-5-11(12,13)14/h4,6H,2-3,5H2,1H3,(H2,15,20)(H3,16,17,18,19) |
| InChIKey | WHKFTYPKLIDXDI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|