C12H16F3N7OS3 — CID 57080273
1-[4-[2-[(4-methoxy-1,2,5-thiadiazol-3-yl)amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 57080273) has the molecular formula C12H16F3N7OS3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-[4-[2-[(4-methoxy-1,2,5-thiadiazol-3-yl)amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[4-[2-[(4-methoxy-1,2,5-thiadiazol-3-yl)amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 57080273 |
| Molecular Formula | C12H16F3N7OS3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 1-[4-[2-[(4-methoxy-1,2,5-thiadiazol-3-yl)amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | COc1nsnc1NCCSCc1csc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H16F3N7OS3/c1-23-9-8(21-26-22-9)17-2-3-24-4-7-5-25-11(19-7)20-10(16)18-6-12(13,14)15/h5H,2-4,6H2,1H3,(H,17,21)(H3,16,18,19,20) |
| InChIKey | UQTSMQLYJCJZTE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|