C13H20F5N7O2S3 — CID 154043547
1-methyl-2-methylsulfonyl-1-[2-[[2-[[N'-(2,2,3,3,3-pentafluoropropyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 154043547) has the molecular formula C13H20F5N7O2S3 and a molecular weight of 497.54 g/mol. Its IUPAC name is 1-methyl-2-methylsulfonyl-1-[2-[[2-[[N'-(2,2,3,3,3-pentafluoropropyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-methyl-2-methylsulfonyl-1-[2-[[2-[[N'-(2,2,3,3,3-pentafluoropropyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 154043547 |
| Molecular Formula | C13H20F5N7O2S3 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 1-methyl-2-methylsulfonyl-1-[2-[[2-[[N'-(2,2,3,3,3-pentafluoropropyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | CN(CCSCc1csc(N/C(N)=N/CC(F)(F)C(F)(F)F)n1)C(N)=NS(C)(=O)=O |
| InChI | InChI=1S/C13H20F5N7O2S3/c1-25(10(20)24-30(2,26)27)3-4-28-5-8-6-29-11(22-8)23-9(19)21-7-12(14,15)13(16,17)18/h6H,3-5,7H2,1-2H3,(H2,20,24)(H3,19,21,22,23) |
| InChIKey | RSBDHJCXQGNMBF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|