C13H22N6O6S3 — CID 54587066
(Z)-but-2-enedioic acid;3-[[2-(2,2-dimethylhydrazinyl)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide (PubChem CID 54587066) has the molecular formula C13H22N6O6S3 and a molecular weight of 454.56 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-[[2-(2,2-dimethylhydrazinyl)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide.
| Compound Name | (Z)-but-2-enedioic acid;3-[[2-(2,2-dimethylhydrazinyl)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
|---|---|
| PubChem CID | 54587066 |
| Molecular Formula | C13H22N6O6S3 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-[[2-(2,2-dimethylhydrazinyl)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| SMILES | CN(C)Nc1nc(CSCC/C(N)=N/S(N)(=O)=O)cs1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H18N6O2S3.C4H4O4/c1-15(2)13-9-12-7(6-19-9)5-18-4-3-8(10)14-20(11,16)17;5-3(6)1-2-4(7)8/h6H,3-5H2,1-2H3,(H2,10,14)(H,12,13)(H2,11,16,17);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | NDBXYKFQCOBNCY-BTJKTKAUSA-N |
| XLogP | -0.07 |
| TPSA | 201.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|