C17H23N7O6S3 — CID 11988382
2-acetyloxybenzoic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide (PubChem CID 11988382) has the molecular formula C17H23N7O6S3 and a molecular weight of 517.62 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide.
| Compound Name | 2-acetyloxybenzoic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
|---|---|
| PubChem CID | 11988382 |
| Molecular Formula | C17H23N7O6S3 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 2-acetyloxybenzoic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.NC(N)=Nc1nc(CSCC/C(N)=N/S(N)(=O)=O)cs1 |
| InChI | InChI=1S/C9H8O4.C8H15N7O2S3/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;9-6(15-20(12,16)17)1-2-18-3-5-4-19-8(13-5)14-7(10)11/h2-5H,1H3,(H,11,12);4H,1-3H2,(H2,9,15)(H2,12,16,17)(H4,10,11,13,14) |
| InChIKey | BUCBCFZAFJVBRY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 239.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|