C11H18N6O2S2 — CID 121321617
3-[[3-(diaminomethylideneamino)phenyl]methylsulfanyl]-N'-sulfamoylpropanimidamide (PubChem CID 121321617) has the molecular formula C11H18N6O2S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 3-[[3-(diaminomethylideneamino)phenyl]methylsulfanyl]-N'-sulfamoylpropanimidamide.
| Compound Name | 3-[[3-(diaminomethylideneamino)phenyl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
|---|---|
| PubChem CID | 121321617 |
| Molecular Formula | C11H18N6O2S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-[[3-(diaminomethylideneamino)phenyl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| SMILES | NC(N)=Nc1cccc(CSCC/C(N)=N/S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H18N6O2S2/c12-10(17-21(15,18)19)4-5-20-7-8-2-1-3-9(6-8)16-11(13)14/h1-3,6H,4-5,7H2,(H2,12,17)(H4,13,14,16)(H2,15,18,19) |
| InChIKey | QFZFVOSBULWZON-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|