C7H14N8O3S2 — CID 12853024
3-[[5-(diaminomethylideneamino)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide (PubChem CID 12853024) has the molecular formula C7H14N8O3S2 and a molecular weight of 322.38 g/mol. Its IUPAC name is 3-[[5-(diaminomethylideneamino)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide.
| Compound Name | 3-[[5-(diaminomethylideneamino)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
|---|---|
| PubChem CID | 12853024 |
| Molecular Formula | C7H14N8O3S2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-[[5-(diaminomethylideneamino)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| SMILES | NC(N)=Nc1nc(CSCC/C(N)=N/S(N)(=O)=O)no1 |
| InChI | InChI=1S/C7H14N8O3S2/c8-4(15-20(11,16)17)1-2-19-3-5-12-7(18-14-5)13-6(9)10/h1-3H2,(H2,8,15)(H2,11,16,17)(H4,9,10,12,13,14) |
| InChIKey | DLKKDDLLJBCZIB-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 201.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|