About 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine
2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine (PubChem CID 150396229) has the molecular formula C6H12N6O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine.
Molecular Properties
| Compound Name | 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine |
| PubChem CID | 150396229 |
| Molecular Formula | C6H12N6O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine |
| SMILES | NCCCc1noc(N=C(N)N)n1 |
| InChI | InChI=1S/C6H12N6O/c7-3-1-2-4-10-6(13-12-4)11-5(8)9/h1-3,7H2,(H4,8,9,10,11,12) |
| InChIKey | HCUCUNJABAOHQE-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine?
The IUPAC name of 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine (CID 150396229) is 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine.
What is the SMILES notation for 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine?
The canonical SMILES for 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine is NCCCc1noc(N=C(N)N)n1.
What is the InChIKey of 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine?
The InChIKey is HCUCUNJABAOHQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N6O/c7-3-1-2-4-10-6(13-12-4)11-5(8)9/h1-3,7H2,(H4,8,9,10,11,12).
What are the key properties of 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine?
2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine has a molecular weight of 184.20 g/mol, XLogP of -1.13, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-aminopropyl)-1,2,4-oxadiazol-5-yl]guanidine is sourced from PubChem (CID 150396229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).