C9H14N2O3S — CID 65129690
ethyl 3-(propylsulfanylmethyl)-1,2,4-oxadiazole-5-carboxylate (PubChem CID 65129690) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is ethyl 3-(propylsulfanylmethyl)-1,2,4-oxadiazole-5-carboxylate.
| Compound Name | ethyl 3-(propylsulfanylmethyl)-1,2,4-oxadiazole-5-carboxylate |
|---|---|
| PubChem CID | 65129690 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | ethyl 3-(propylsulfanylmethyl)-1,2,4-oxadiazole-5-carboxylate |
| SMILES | CCCSCc1noc(C(=O)OCC)n1 |
| InChI | InChI=1S/C9H14N2O3S/c1-3-5-15-6-7-10-8(14-11-7)9(12)13-4-2/h3-6H2,1-2H3 |
| InChIKey | BLKDUTDRBVFSIL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|