C9H19Cl2N5S2 — CID 70480823
1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-1,2-dimethylguanidine;dihydrochloride (PubChem CID 70480823) has the molecular formula C9H19Cl2N5S2 and a molecular weight of 332.33 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-1,2-dimethylguanidine;dihydrochloride.
| Compound Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-1,2-dimethylguanidine;dihydrochloride |
|---|---|
| PubChem CID | 70480823 |
| Molecular Formula | C9H19Cl2N5S2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-1,2-dimethylguanidine;dihydrochloride |
| SMILES | C/N=C(\N)N(C)c1nc(CSCCN)cs1.Cl.Cl |
| InChI | InChI=1S/C9H17N5S2.2ClH/c1-12-8(11)14(2)9-13-7(6-16-9)5-15-4-3-10;;/h6H,3-5,10H2,1-2H3,(H2,11,12);2*1H |
| InChIKey | UYMBBTHWPBKRLQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|