C10H12N2OS2 — CID 43249527
2-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylsulfanyl]ethanamine (PubChem CID 43249527) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylsulfanyl]ethanamine.
| Compound Name | 2-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 43249527 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylsulfanyl]ethanamine |
| SMILES | NCCSCc1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C10H12N2OS2/c11-3-5-14-6-8-7-15-10(12-8)9-2-1-4-13-9/h1-2,4,7H,3,5-6,11H2 |
| InChIKey | UYHYOUBFOXTBEV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|