C13H10N2O2S2 — CID 47141927
2-(furan-2-yl)-4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-thiazole (PubChem CID 47141927) has the molecular formula C13H10N2O2S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-thiazole.
| Compound Name | 2-(furan-2-yl)-4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 47141927 |
| Molecular Formula | C13H10N2O2S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-(furan-2-yl)-4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-thiazole |
| SMILES | [O-][n+]1ccccc1SCc1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C13H10N2O2S2/c16-15-6-2-1-5-12(15)18-8-10-9-19-13(14-10)11-4-3-7-17-11/h1-7,9H,8H2 |
| InChIKey | YXZOWQPORDUWBL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|