C11H22Cl2N6OS2 — CID 70552639
[N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]carbamimidoyl]urea;dihydrochloride (PubChem CID 70552639) has the molecular formula C11H22Cl2N6OS2 and a molecular weight of 389.38 g/mol. Its IUPAC name is [N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]carbamimidoyl]urea;dihydrochloride.
| Compound Name | [N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]carbamimidoyl]urea;dihydrochloride |
|---|---|
| PubChem CID | 70552639 |
| Molecular Formula | C11H22Cl2N6OS2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]carbamimidoyl]urea;dihydrochloride |
| SMILES | CN(C)Cc1nc(CSCC/N=C(\N)NC(N)=O)cs1.Cl.Cl |
| InChI | InChI=1S/C11H20N6OS2.2ClH/c1-17(2)5-9-15-8(7-20-9)6-19-4-3-14-10(12)16-11(13)18;;/h7H,3-6H2,1-2H3,(H5,12,13,14,16,18);2*1H |
| InChIKey | IOIZVPOZXDAEJB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|