C10H15N5O2S3 — CID 135849638
4-N-methyl-3-N-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine (PubChem CID 135849638) has the molecular formula C10H15N5O2S3 and a molecular weight of 333.46 g/mol. Its IUPAC name is 4-N-methyl-3-N-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine.
| Compound Name | 4-N-methyl-3-N-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine |
|---|---|
| PubChem CID | 135849638 |
| Molecular Formula | C10H15N5O2S3 |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4-N-methyl-3-N-[2-[(3-methyl-1,2-thiazol-4-yl)methylsulfanyl]ethyl]-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine |
| SMILES | C/N=C1\NS(=O)(=O)N\C1=N\CCSCc1csnc1C |
| InChI | InChI=1S/C10H15N5O2S3/c1-7-8(6-19-13-7)5-18-4-3-12-10-9(11-2)14-20(16,17)15-10/h6H,3-5H2,1-2H3,(H,11,14)(H,12,15) |
| InChIKey | FFTPGLOZXFHXDR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|