C10H15N5O4S2 — CID 135849629
[5-[2-[(4-methoxy-1,1-dioxo-1,2,5-thiadiazol-3-ylidene)amino]ethylsulfanylmethyl]-1H-imidazol-4-yl]methanol (PubChem CID 135849629) has the molecular formula C10H15N5O4S2 and a molecular weight of 333.40 g/mol. Its IUPAC name is [5-[2-[(4-methoxy-1,1-dioxo-1,2,5-thiadiazol-3-ylidene)amino]ethylsulfanylmethyl]-1H-imidazol-4-yl]methanol.
| Compound Name | [5-[2-[(4-methoxy-1,1-dioxo-1,2,5-thiadiazol-3-ylidene)amino]ethylsulfanylmethyl]-1H-imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 135849629 |
| Molecular Formula | C10H15N5O4S2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [5-[2-[(4-methoxy-1,1-dioxo-1,2,5-thiadiazol-3-ylidene)amino]ethylsulfanylmethyl]-1H-imidazol-4-yl]methanol |
| SMILES | COC1=NS(=O)(=O)N/C1=N/CCSCc1[nH]cnc1CO |
| InChI | InChI=1S/C10H15N5O4S2/c1-19-10-9(14-21(17,18)15-10)11-2-3-20-5-8-7(4-16)12-6-13-8/h6,16H,2-5H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | LFNRASVHZBQHII-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|