C14H21N5O2S2 — CID 135849653
4-[2-[[3-(2-aminopropan-2-yl)phenyl]methylsulfanyl]ethylimino]-1,1-dioxo-1,2,5-thiadiazol-3-amine (PubChem CID 135849653) has the molecular formula C14H21N5O2S2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 4-[2-[[3-(2-aminopropan-2-yl)phenyl]methylsulfanyl]ethylimino]-1,1-dioxo-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-[2-[[3-(2-aminopropan-2-yl)phenyl]methylsulfanyl]ethylimino]-1,1-dioxo-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 135849653 |
| Molecular Formula | C14H21N5O2S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-[2-[[3-(2-aminopropan-2-yl)phenyl]methylsulfanyl]ethylimino]-1,1-dioxo-1,2,5-thiadiazol-3-amine |
| SMILES | CC(C)(N)c1cccc(CSCC/N=C2/NS(=O)(=O)N=C2N)c1 |
| InChI | InChI=1S/C14H21N5O2S2/c1-14(2,16)11-5-3-4-10(8-11)9-22-7-6-17-13-12(15)18-23(20,21)19-13/h3-5,8H,6-7,9,16H2,1-2H3,(H2,15,18)(H,17,19) |
| InChIKey | QEHJJZYYDIXKMU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|