C12H14F3NS — CID 66289904
3-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]azetidine (PubChem CID 66289904) has the molecular formula C12H14F3NS and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]azetidine.
| Compound Name | 3-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]azetidine |
|---|---|
| PubChem CID | 66289904 |
| Molecular Formula | C12H14F3NS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]azetidine |
| SMILES | FC(F)(F)c1cccc(CSCC2CNC2)c1 |
| InChI | InChI=1S/C12H14F3NS/c13-12(14,15)11-3-1-2-9(4-11)7-17-8-10-5-16-6-10/h1-4,10,16H,5-8H2 |
| InChIKey | QKDCUCIMXFQHFF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |