C13H14F3NO2S — CID 121493737
3-hydroxy-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]piperidin-2-one (PubChem CID 121493737) has the molecular formula C13H14F3NO2S and a molecular weight of 305.32 g/mol. Its IUPAC name is 3-hydroxy-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]piperidin-2-one.
| Compound Name | 3-hydroxy-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]piperidin-2-one |
|---|---|
| PubChem CID | 121493737 |
| Molecular Formula | C13H14F3NO2S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-hydroxy-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]piperidin-2-one |
| SMILES | O=C1NCC(SCc2cccc(C(F)(F)F)c2)CC1O |
| InChI | InChI=1S/C13H14F3NO2S/c14-13(15,16)9-3-1-2-8(4-9)7-20-10-5-11(18)12(19)17-6-10/h1-4,10-11,18H,5-7H2,(H,17,19) |
| InChIKey | IKINOKLNQFPCGJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |