C13H18ClF3N2O — CID 120962314
4-[[[3-(trifluoromethyl)phenyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride (PubChem CID 120962314) has the molecular formula C13H18ClF3N2O and a molecular weight of 310.75 g/mol. Its IUPAC name is 4-[[[3-(trifluoromethyl)phenyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride.
| Compound Name | 4-[[[3-(trifluoromethyl)phenyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120962314 |
| Molecular Formula | C13H18ClF3N2O |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-[[[3-(trifluoromethyl)phenyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
| SMILES | Cl.OC1CNCC1CNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O.ClH/c14-13(15,16)11-3-1-2-9(4-11)5-17-6-10-7-18-8-12(10)19;/h1-4,10,12,17-19H,5-8H2;1H |
| InChIKey | YDQKKFAPUXGDPK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |