C19H20ClF3N2 — CID 67218389
1-[4-(3-chlorophenyl)pyrrolidin-3-yl]-N-[[4-(trifluoromethyl)phenyl]methyl]methanamine (PubChem CID 67218389) has the molecular formula C19H20ClF3N2 and a molecular weight of 368.83 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)pyrrolidin-3-yl]-N-[[4-(trifluoromethyl)phenyl]methyl]methanamine.
| Compound Name | 1-[4-(3-chlorophenyl)pyrrolidin-3-yl]-N-[[4-(trifluoromethyl)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 67218389 |
| Molecular Formula | C19H20ClF3N2 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-[4-(3-chlorophenyl)pyrrolidin-3-yl]-N-[[4-(trifluoromethyl)phenyl]methyl]methanamine |
| SMILES | FC(F)(F)c1ccc(CNCC2CNCC2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H20ClF3N2/c20-17-3-1-2-14(8-17)18-12-25-11-15(18)10-24-9-13-4-6-16(7-5-13)19(21,22)23/h1-8,15,18,24-25H,9-12H2 |
| InChIKey | DQFCCSCSTTZIJZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |