C13H18ClN — CID 125452847
(3S,4R)-3-(3-chlorophenyl)-4-propylpyrrolidine (PubChem CID 125452847) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is (3S,4R)-3-(3-chlorophenyl)-4-propylpyrrolidine.
| Compound Name | (3S,4R)-3-(3-chlorophenyl)-4-propylpyrrolidine |
|---|---|
| PubChem CID | 125452847 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (3S,4R)-3-(3-chlorophenyl)-4-propylpyrrolidine |
| SMILES | CCC[C@H]1CNC[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN/c1-2-4-11-8-15-9-13(11)10-5-3-6-12(14)7-10/h3,5-7,11,13,15H,2,4,8-9H2,1H3/t11-,13+/m0/s1 |
| InChIKey | LZWHRYWTICDSQE-WCQYABFASA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |