C21H22F3NO2S — CID 86961784
N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 86961784) has the molecular formula C21H22F3NO2S and a molecular weight of 409.47 g/mol. Its IUPAC name is N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86961784 |
| Molecular Formula | C21H22F3NO2S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)Nc1cccc(CSC2CCOCC2)c1 |
| InChI | InChI=1S/C21H22F3NO2S/c22-21(23,24)17-5-1-3-15(11-17)13-20(26)25-18-6-2-4-16(12-18)14-28-19-7-9-27-10-8-19/h1-6,11-12,19H,7-10,13-14H2,(H,25,26) |
| InChIKey | QPQITFUMGRZRFR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |