C23H29NO3S — CID 86961736
3-(2-ethoxyphenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]propanamide (PubChem CID 86961736) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]propanamide.
| Compound Name | 3-(2-ethoxyphenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 86961736 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3-(2-ethoxyphenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]propanamide |
| SMILES | CCOc1ccccc1CCC(=O)Nc1cccc(CSC2CCOCC2)c1 |
| InChI | InChI=1S/C23H29NO3S/c1-2-27-22-9-4-3-7-19(22)10-11-23(25)24-20-8-5-6-18(16-20)17-28-21-12-14-26-15-13-21/h3-9,16,21H,2,10-15,17H2,1H3,(H,24,25) |
| InChIKey | JOROYBBJGOUAIR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |