C23H30N2O2S — CID 86962680
1-[3-(oxan-4-ylsulfanylmethyl)phenyl]-3-(2-phenylbutan-2-yl)urea (PubChem CID 86962680) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-[3-(oxan-4-ylsulfanylmethyl)phenyl]-3-(2-phenylbutan-2-yl)urea.
| Compound Name | 1-[3-(oxan-4-ylsulfanylmethyl)phenyl]-3-(2-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 86962680 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[3-(oxan-4-ylsulfanylmethyl)phenyl]-3-(2-phenylbutan-2-yl)urea |
| SMILES | CCC(C)(NC(=O)Nc1cccc(CSC2CCOCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O2S/c1-3-23(2,19-9-5-4-6-10-19)25-22(26)24-20-11-7-8-18(16-20)17-28-21-12-14-27-15-13-21/h4-11,16,21H,3,12-15,17H2,1-2H3,(H2,24,25,26) |
| InChIKey | HOJKGSAFFJEQLM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |