C17H19NO3S — CID 71875712
N-[3-(oxan-4-ylsulfanylmethyl)phenyl]furan-3-carboxamide (PubChem CID 71875712) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[3-(oxan-4-ylsulfanylmethyl)phenyl]furan-3-carboxamide.
| Compound Name | N-[3-(oxan-4-ylsulfanylmethyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 71875712 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[3-(oxan-4-ylsulfanylmethyl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1cccc(CSC2CCOCC2)c1)c1ccoc1 |
| InChI | InChI=1S/C17H19NO3S/c19-17(14-4-7-21-11-14)18-15-3-1-2-13(10-15)12-22-16-5-8-20-9-6-16/h1-4,7,10-11,16H,5-6,8-9,12H2,(H,18,19) |
| InChIKey | QDRYEDLHRNYLRR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |