C23H26N2O3S — CID 86961775
N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 86961775) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 86961775 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1cccc(CSC2CCOCC2)c1)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C23H26N2O3S/c26-22-8-3-11-25(22)20-7-2-5-18(15-20)23(27)24-19-6-1-4-17(14-19)16-29-21-9-12-28-13-10-21/h1-2,4-7,14-15,21H,3,8-13,16H2,(H,24,27) |
| InChIKey | VMUPSKHXQHZCKV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |