C23H25N3O2S2 — CID 86961638
3-(2-methylsulfanylimidazol-1-yl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]benzamide (PubChem CID 86961638) has the molecular formula C23H25N3O2S2 and a molecular weight of 439.61 g/mol. Its IUPAC name is 3-(2-methylsulfanylimidazol-1-yl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]benzamide.
| Compound Name | 3-(2-methylsulfanylimidazol-1-yl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 86961638 |
| Molecular Formula | C23H25N3O2S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-(2-methylsulfanylimidazol-1-yl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]benzamide |
| SMILES | CSc1nccn1-c1cccc(C(=O)Nc2cccc(CSC3CCOCC3)c2)c1 |
| InChI | InChI=1S/C23H25N3O2S2/c1-29-23-24-10-11-26(23)20-7-3-5-18(15-20)22(27)25-19-6-2-4-17(14-19)16-30-21-8-12-28-13-9-21/h2-7,10-11,14-15,21H,8-9,12-13,16H2,1H3,(H,25,27) |
| InChIKey | MKABGEOCERWVOF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |