C26H24N4O2S — CID 55771473
2-[[3-(2-methylsulfanylimidazol-1-yl)benzoyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 55771473) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is 2-[[3-(2-methylsulfanylimidazol-1-yl)benzoyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[3-(2-methylsulfanylimidazol-1-yl)benzoyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 55771473 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[[3-(2-methylsulfanylimidazol-1-yl)benzoyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | CSc1nccn1-c1cccc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H24N4O2S/c1-33-26-28-16-17-30(26)21-11-7-10-20(18-21)24(31)29-23-13-6-5-12-22(23)25(32)27-15-14-19-8-3-2-4-9-19/h2-13,16-18H,14-15H2,1H3,(H,27,32)(H,29,31) |
| InChIKey | MVVFPTYCOPNIRF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |