C22H24ClNO3S — CID 86962233
4-(4-chlorophenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-4-oxobutanamide (PubChem CID 86962233) has the molecular formula C22H24ClNO3S and a molecular weight of 417.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 86962233 |
| Molecular Formula | C22H24ClNO3S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1)Nc1cccc(CSC2CCOCC2)c1 |
| InChI | InChI=1S/C22H24ClNO3S/c23-18-6-4-17(5-7-18)21(25)8-9-22(26)24-19-3-1-2-16(14-19)15-28-20-10-12-27-13-11-20/h1-7,14,20H,8-13,15H2,(H,24,26) |
| InChIKey | MJNUBSULJOXYOI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |