C23H27NO3S — CID 86961651
(E)-3-(4-ethoxyphenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]prop-2-enamide (PubChem CID 86961651) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86961651 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2cccc(CSC3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C23H27NO3S/c1-2-27-21-9-6-18(7-10-21)8-11-23(25)24-20-5-3-4-19(16-20)17-28-22-12-14-26-15-13-22/h3-11,16,22H,2,12-15,17H2,1H3,(H,24,25)/b11-8+ |
| InChIKey | JQMNXQPRWLEYLB-DHZHZOJOSA-N |
| XLogP | 5.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|