C23H24N2O3S — CID 86961739
(E)-3-[4-(cyanomethoxy)phenyl]-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]prop-2-enamide (PubChem CID 86961739) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is (E)-3-[4-(cyanomethoxy)phenyl]-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(cyanomethoxy)phenyl]-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86961739 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (E)-3-[4-(cyanomethoxy)phenyl]-N-[3-(oxan-4-ylsulfanylmethyl)phenyl]prop-2-enamide |
| SMILES | N#CCOc1ccc(/C=C/C(=O)Nc2cccc(CSC3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C23H24N2O3S/c24-12-15-28-21-7-4-18(5-8-21)6-9-23(26)25-20-3-1-2-19(16-20)17-29-22-10-13-27-14-11-22/h1-9,16,22H,10-11,13-15,17H2,(H,25,26)/b9-6+ |
| InChIKey | VERTXTLOVAIMCU-RMKNXTFCSA-N |
| XLogP | 4.65 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|