C15H19N9OS3 — CID 173418629
2-[4-[2-[[1-oxido-4-(pyridin-3-ylmethylimino)-1,2,5-thiadiazolidin-1-ium-3-ylidene]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 173418629) has the molecular formula C15H19N9OS3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-[4-[2-[[1-oxido-4-(pyridin-3-ylmethylimino)-1,2,5-thiadiazolidin-1-ium-3-ylidene]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[2-[[1-oxido-4-(pyridin-3-ylmethylimino)-1,2,5-thiadiazolidin-1-ium-3-ylidene]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 173418629 |
| Molecular Formula | C15H19N9OS3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[4-[2-[[1-oxido-4-(pyridin-3-ylmethylimino)-1,2,5-thiadiazolidin-1-ium-3-ylidene]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(CSCC/N=c2\[nH][s+]([O-])[nH]\c2=N/Cc2cccnc2)cs1 |
| InChI | InChI=1S/C15H19N9OS3/c16-14(17)22-15-21-11(9-27-15)8-26-5-4-19-12-13(24-28(25)23-12)20-7-10-2-1-3-18-6-10/h1-3,6,9H,4-5,7-8H2,(H,19,23)(H,20,24)(H4,16,17,21,22) |
| InChIKey | QRDHAIXCYZTGSI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 169.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|