C14H18N4O3S2 — CID 173366358
ethyl 4-amino-1-oxido-3-[2-(pyridin-2-ylmethylsulfanyl)ethylimino]-1,2-thiazol-1-ium-5-carboxylate (PubChem CID 173366358) has the molecular formula C14H18N4O3S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is ethyl 4-amino-1-oxido-3-[2-(pyridin-2-ylmethylsulfanyl)ethylimino]-1,2-thiazol-1-ium-5-carboxylate.
| Compound Name | ethyl 4-amino-1-oxido-3-[2-(pyridin-2-ylmethylsulfanyl)ethylimino]-1,2-thiazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 173366358 |
| Molecular Formula | C14H18N4O3S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | ethyl 4-amino-1-oxido-3-[2-(pyridin-2-ylmethylsulfanyl)ethylimino]-1,2-thiazol-1-ium-5-carboxylate |
| SMILES | CCOC(=O)c1c(N)/c(=N/CCSCc2ccccn2)[nH][s+]1[O-] |
| InChI | InChI=1S/C14H18N4O3S2/c1-2-21-14(19)12-11(15)13(18-23(12)20)17-7-8-22-9-10-5-3-4-6-16-10/h3-6H,2,7-9,15H2,1H3,(H,17,18) |
| InChIKey | UAHFVCPSIAQLSP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|