C17H20IN3OS2 — CID 173429929
methyl N-benzoyl-N'-[2-(pyridin-2-ylmethylsulfanyl)ethyl]carbamimidothioate;hydroiodide (PubChem CID 173429929) has the molecular formula C17H20IN3OS2 and a molecular weight of 473.41 g/mol. Its IUPAC name is methyl N-benzoyl-N'-[2-(pyridin-2-ylmethylsulfanyl)ethyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N-benzoyl-N'-[2-(pyridin-2-ylmethylsulfanyl)ethyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 173429929 |
| Molecular Formula | C17H20IN3OS2 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | methyl N-benzoyl-N'-[2-(pyridin-2-ylmethylsulfanyl)ethyl]carbamimidothioate;hydroiodide |
| SMILES | CS/C(=N\CCSCc1ccccn1)NC(=O)c1ccccc1.I |
| InChI | InChI=1S/C17H19N3OS2.HI/c1-22-17(20-16(21)14-7-3-2-4-8-14)19-11-12-23-13-15-9-5-6-10-18-15;/h2-10H,11-13H2,1H3,(H,19,20,21);1H |
| InChIKey | SDDOXRCNAIDNTQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|