C11H16N2OS — CID 10398724
methyl 4-(pyridin-2-ylmethylsulfanyl)butanimidate (PubChem CID 10398724) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is methyl 4-(pyridin-2-ylmethylsulfanyl)butanimidate.
| Compound Name | methyl 4-(pyridin-2-ylmethylsulfanyl)butanimidate |
|---|---|
| PubChem CID | 10398724 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl 4-(pyridin-2-ylmethylsulfanyl)butanimidate |
| SMILES | [H]/N=C(/CCCSCc1ccccn1)OC |
| InChI | InChI=1S/C11H16N2OS/c1-14-11(12)6-4-8-15-9-10-5-2-3-7-13-10/h2-3,5,7,12H,4,6,8-9H2,1H3/b12-11- |
| InChIKey | HVIAYSNMRRFFHS-QXMHVHEDSA-N |
| XLogP | 2.72 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|