C20H26N2O3S — CID 47516128
N-(2-butoxy-5-methoxyphenyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide (PubChem CID 47516128) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-(2-butoxy-5-methoxyphenyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide.
| Compound Name | N-(2-butoxy-5-methoxyphenyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 47516128 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-(2-butoxy-5-methoxyphenyl)-3-(pyridin-2-ylmethylsulfanyl)propanamide |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)CCSCc1ccccn1 |
| InChI | InChI=1S/C20H26N2O3S/c1-3-4-12-25-19-9-8-17(24-2)14-18(19)22-20(23)10-13-26-15-16-7-5-6-11-21-16/h5-9,11,14H,3-4,10,12-13,15H2,1-2H3,(H,22,23) |
| InChIKey | DJANTWBDKNBRJV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|