C15H18IN3OS3 — CID 173429898
methyl N-benzoyl-N'-[2-(1,2-thiazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate;hydroiodide (PubChem CID 173429898) has the molecular formula C15H18IN3OS3 and a molecular weight of 479.43 g/mol. Its IUPAC name is methyl N-benzoyl-N'-[2-(1,2-thiazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N-benzoyl-N'-[2-(1,2-thiazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 173429898 |
| Molecular Formula | C15H18IN3OS3 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | methyl N-benzoyl-N'-[2-(1,2-thiazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate;hydroiodide |
| SMILES | CS/C(=N\CCSCc1ccsn1)NC(=O)c1ccccc1.I |
| InChI | InChI=1S/C15H17N3OS3.HI/c1-20-15(17-14(19)12-5-3-2-4-6-12)16-8-10-21-11-13-7-9-22-18-13;/h2-7,9H,8,10-11H2,1H3,(H,16,17,19);1H |
| InChIKey | XNVSGJMVQRFRTR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|