C32H28N4O3S — CID 126497909
methyl N-benzoyl-N'-[1-[(4-methoxyphenyl)methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamimidothioate (PubChem CID 126497909) has the molecular formula C32H28N4O3S and a molecular weight of 548.67 g/mol. Its IUPAC name is methyl N-benzoyl-N'-[1-[(4-methoxyphenyl)methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamimidothioate.
| Compound Name | methyl N-benzoyl-N'-[1-[(4-methoxyphenyl)methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamimidothioate |
|---|---|
| PubChem CID | 126497909 |
| Molecular Formula | C32H28N4O3S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | methyl N-benzoyl-N'-[1-[(4-methoxyphenyl)methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamimidothioate |
| SMILES | COc1ccc(CN2C(=O)C(/N=C(/NC(=O)c3ccccc3)SC)N=C(c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H28N4O3S/c1-39-25-19-17-22(18-20-25)21-36-27-16-10-9-15-26(27)28(23-11-5-3-6-12-23)33-29(31(36)38)34-32(40-2)35-30(37)24-13-7-4-8-14-24/h3-20,29H,21H2,1-2H3,(H,34,35,37) |
| InChIKey | QKSWMFNTCQEUFU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|