C25H24N4O2S — CID 167158940
[1-[(4-methoxyphenyl)methyl]-3-methyl-2-oxo-5-phenyl-1,4-benzodiazepin-3-yl]thiourea (PubChem CID 167158940) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is [1-[(4-methoxyphenyl)methyl]-3-methyl-2-oxo-5-phenyl-1,4-benzodiazepin-3-yl]thiourea.
| Compound Name | [1-[(4-methoxyphenyl)methyl]-3-methyl-2-oxo-5-phenyl-1,4-benzodiazepin-3-yl]thiourea |
|---|---|
| PubChem CID | 167158940 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [1-[(4-methoxyphenyl)methyl]-3-methyl-2-oxo-5-phenyl-1,4-benzodiazepin-3-yl]thiourea |
| SMILES | COc1ccc(CN2C(=O)C(C)(NC(N)=S)N=C(c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H24N4O2S/c1-25(28-24(26)32)23(30)29(16-17-12-14-19(31-2)15-13-17)21-11-7-6-10-20(21)22(27-25)18-8-4-3-5-9-18/h3-15H,16H2,1-2H3,(H3,26,28,32) |
| InChIKey | SQPSSQFYGCDPDB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|