C27H25N3O4 — CID 50829901
4-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]-N-(4-methoxyphenyl)benzamide (PubChem CID 50829901) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 4-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 4-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 50829901 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(CN3C(=O)C4CCCN4C(=O)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O4/c1-34-21-14-12-20(13-15-21)28-25(31)19-10-8-18(9-11-19)17-30-23-6-3-2-5-22(23)26(32)29-16-4-7-24(29)27(30)33/h2-3,5-6,8-15,24H,4,7,16-17H2,1H3,(H,28,31) |
| InChIKey | VLEDHJLXEZRMPD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |