C28H27N3O4 — CID 93061748
3-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 93061748) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 3-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 93061748 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2cccc(CN3C(=O)[C@@H]4CCCN4C(=O)c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C28H27N3O4/c1-35-22-13-11-19(12-14-22)17-29-26(32)21-7-4-6-20(16-21)18-31-24-9-3-2-8-23(24)27(33)30-15-5-10-25(30)28(31)34/h2-4,6-9,11-14,16,25H,5,10,15,17-18H2,1H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | UJDBGZOREWLLMQ-VWLOTQADSA-N |
| XLogP | 3.78 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |