C27H24ClN3O3 — CID 93062077
3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(3-chlorophenyl)methyl]benzamide (PubChem CID 93062077) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(3-chlorophenyl)methyl]benzamide.
| Compound Name | 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(3-chlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 93062077 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(3-chlorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1cccc(CN2C(=O)[C@H]3CCCN3C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C27H24ClN3O3/c28-21-9-4-6-18(15-21)16-29-25(32)20-8-3-7-19(14-20)17-31-23-11-2-1-10-22(23)26(33)30-13-5-12-24(30)27(31)34/h1-4,6-11,14-15,24H,5,12-13,16-17H2,(H,29,32)/t24-/m1/s1 |
| InChIKey | VZBWXHHSRWWOIW-XMMPIXPASA-N |
| XLogP | 4.42 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |