C26H31N3O4 — CID 93062120
3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-(3-propan-2-yloxypropyl)benzamide (PubChem CID 93062120) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-(3-propan-2-yloxypropyl)benzamide.
| Compound Name | 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-(3-propan-2-yloxypropyl)benzamide |
|---|---|
| PubChem CID | 93062120 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-(3-propan-2-yloxypropyl)benzamide |
| SMILES | CC(C)OCCCNC(=O)c1cccc(CN2C(=O)[C@H]3CCCN3C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C26H31N3O4/c1-18(2)33-15-7-13-27-24(30)20-9-5-8-19(16-20)17-29-22-11-4-3-10-21(22)25(31)28-14-6-12-23(28)26(29)32/h3-5,8-11,16,18,23H,6-7,12-15,17H2,1-2H3,(H,27,30)/t23-/m1/s1 |
| InChIKey | LKKPYLROCXIOMX-HSZRJFAPSA-N |
| XLogP | 3.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|