C29H29N3O5 — CID 53031555
N-[(2,4-dimethoxyphenyl)methyl]-3-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide (PubChem CID 53031555) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53031555 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2cccc(CN3C(=O)C4CCCN4C(=O)c4ccccc43)c2)c(OC)c1 |
| InChI | InChI=1S/C29H29N3O5/c1-36-22-13-12-21(26(16-22)37-2)17-30-27(33)20-8-5-7-19(15-20)18-32-24-10-4-3-9-23(24)28(34)31-14-6-11-25(31)29(32)35/h3-5,7-10,12-13,15-16,25H,6,11,14,17-18H2,1-2H3,(H,30,33) |
| InChIKey | UTDPKYAEVCCXKE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |