C29H29N3O3 — CID 93061794
3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(1S)-1-(4-methylphenyl)ethyl]benzamide (PubChem CID 93061794) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(1S)-1-(4-methylphenyl)ethyl]benzamide.
| Compound Name | 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(1S)-1-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 93061794 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-[[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(1S)-1-(4-methylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc([C@H](C)NC(=O)c2cccc(CN3C(=O)[C@H]4CCCN4C(=O)c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C29H29N3O3/c1-19-12-14-22(15-13-19)20(2)30-27(33)23-8-5-7-21(17-23)18-32-25-10-4-3-9-24(25)28(34)31-16-6-11-26(31)29(32)35/h3-5,7-10,12-15,17,20,26H,6,11,16,18H2,1-2H3,(H,30,33)/t20-,26+/m0/s1 |
| InChIKey | WYLURZUHVIYACS-RXFWQSSRSA-N |
| XLogP | 4.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |