C30H31N3O3 — CID 53031641
N-[1-(3,4-dimethylphenyl)ethyl]-3-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide (PubChem CID 53031641) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)ethyl]-3-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)ethyl]-3-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53031641 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)ethyl]-3-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2cccc(CN3C(=O)C4CCCN4C(=O)c4ccccc43)c2)cc1C |
| InChI | InChI=1S/C30H31N3O3/c1-19-13-14-23(16-20(19)2)21(3)31-28(34)24-9-6-8-22(17-24)18-33-26-11-5-4-10-25(26)29(35)32-15-7-12-27(32)30(33)36/h4-6,8-11,13-14,16-17,21,27H,7,12,15,18H2,1-3H3,(H,31,34) |
| InChIKey | MZBSHUKWPSVGQG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |