C20H30N6O3S — CID 110183836
N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-6-(4-methylpiperazin-1-yl)-3-nitropyridin-2-amine (PubChem CID 110183836) has the molecular formula C20H30N6O3S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-6-(4-methylpiperazin-1-yl)-3-nitropyridin-2-amine.
| Compound Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-6-(4-methylpiperazin-1-yl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 110183836 |
| Molecular Formula | C20H30N6O3S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-6-(4-methylpiperazin-1-yl)-3-nitropyridin-2-amine |
| SMILES | CN(C)Cc1ccc(CSCCNc2nc(N3CCN(C)CC3)ccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C20H30N6O3S/c1-23(2)14-16-4-5-17(29-16)15-30-13-8-21-20-18(26(27)28)6-7-19(22-20)25-11-9-24(3)10-12-25/h4-7H,8-15H2,1-3H3,(H,21,22) |
| InChIKey | FXFFMDAVOCIQGO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|