C14H20N4O4 — CID 110173650
2-[(3-nitro-6-piperidin-1-yl-2-pyridinyl)amino]ethyl acetate (PubChem CID 110173650) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[(3-nitro-6-piperidin-1-yl-2-pyridinyl)amino]ethyl acetate.
| Compound Name | 2-[(3-nitro-6-piperidin-1-yl-2-pyridinyl)amino]ethyl acetate |
|---|---|
| PubChem CID | 110173650 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-[(3-nitro-6-piperidin-1-yl-2-pyridinyl)amino]ethyl acetate |
| SMILES | CC(=O)OCCNc1nc(N2CCCCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O4/c1-11(19)22-10-7-15-14-12(18(20)21)5-6-13(16-14)17-8-3-2-4-9-17/h5-6H,2-4,7-10H2,1H3,(H,15,16) |
| InChIKey | POFWIJZHHOENSL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|