C27H38Cl2N6O3S — CID 110184018
dimethyl-[[5-[2-[[6-[3-methyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-3-nitro-2-pyridinyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]azanium dichloride (PubChem CID 110184018) has the molecular formula C27H38Cl2N6O3S and a molecular weight of 597.61 g/mol. Its IUPAC name is dimethyl-[[5-[2-[[6-[3-methyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-3-nitro-2-pyridinyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]azanium dichloride.
| Compound Name | dimethyl-[[5-[2-[[6-[3-methyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-3-nitro-2-pyridinyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]azanium dichloride |
|---|---|
| PubChem CID | 110184018 |
| Molecular Formula | C27H38Cl2N6O3S |
| Molecular Weight | 597.61 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | dimethyl-[[5-[2-[[6-[3-methyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-3-nitro-2-pyridinyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]azanium dichloride |
| SMILES | Cc1cccc([NH+]2CCN(c3ccc([N+](=O)[O-])c(NCCSCc4ccc(C[NH+](C)C)o4)n3)CC2C)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H36N6O3S.2ClH/c1-20-6-5-7-22(16-20)32-14-13-31(17-21(32)2)26-11-10-25(33(34)35)27(29-26)28-12-15-37-19-24-9-8-23(36-24)18-30(3)4;;/h5-11,16,21H,12-15,17-19H2,1-4H3,(H,28,29);2*1H |
| InChIKey | NCALOTSJSBDGOQ-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.61 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|