C23H32N6O3 — CID 110172016
6-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-N-(2-morpholin-4-ylethyl)-3-nitropyridin-2-amine (PubChem CID 110172016) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 6-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-N-(2-morpholin-4-ylethyl)-3-nitropyridin-2-amine.
| Compound Name | 6-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-N-(2-morpholin-4-ylethyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 110172016 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 6-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-N-(2-morpholin-4-ylethyl)-3-nitropyridin-2-amine |
| SMILES | Cc1cccc(CN2CCN(c3ccc([N+](=O)[O-])c(NCCN4CCOCC4)n3)CC2)c1 |
| InChI | InChI=1S/C23H32N6O3/c1-19-3-2-4-20(17-19)18-27-9-11-28(12-10-27)22-6-5-21(29(30)31)23(25-22)24-7-8-26-13-15-32-16-14-26/h2-6,17H,7-16,18H2,1H3,(H,24,25) |
| InChIKey | QSZGFEHFYQQJDW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 87.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|